C18H15F3N2O4 — CID 46552704
2,5-dioxo-N-[4-(2,2,2-trifluoroethoxy)phenyl]-1,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 46552704) has the molecular formula C18H15F3N2O4 and a molecular weight of 380.32 g/mol. Its IUPAC name is 2,5-dioxo-N-[4-(2,2,2-trifluoroethoxy)phenyl]-1,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 2,5-dioxo-N-[4-(2,2,2-trifluoroethoxy)phenyl]-1,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46552704 |
| Molecular Formula | C18H15F3N2O4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2,5-dioxo-N-[4-(2,2,2-trifluoroethoxy)phenyl]-1,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | O=C1CCCc2[nH]c(=O)c(C(=O)Nc3ccc(OCC(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C18H15F3N2O4/c19-18(20,21)9-27-11-6-4-10(5-7-11)22-16(25)13-8-12-14(23-17(13)26)2-1-3-15(12)24/h4-8H,1-3,9H2,(H,22,25)(H,23,26) |
| InChIKey | VQAYWIGXQGNCRY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |