C22H24N2O2 — CID 4655442
2-(3-butanoylindol-1-yl)-N-(2-phenylethyl)acetamide (PubChem CID 4655442) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-(3-butanoylindol-1-yl)-N-(2-phenylethyl)acetamide.
| Compound Name | 2-(3-butanoylindol-1-yl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 4655442 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-(3-butanoylindol-1-yl)-N-(2-phenylethyl)acetamide |
| SMILES | CCCC(=O)c1cn(CC(=O)NCCc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C22H24N2O2/c1-2-8-21(25)19-15-24(20-12-7-6-11-18(19)20)16-22(26)23-14-13-17-9-4-3-5-10-17/h3-7,9-12,15H,2,8,13-14,16H2,1H3,(H,23,26) |
| InChIKey | FREXBJGSEUDIRD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |