C19H22N4O4S — CID 46563354
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 46563354) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 46563354 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)C(=O)C1=CN2CCS(=O)(=O)N=C2C=C1 |
| InChI | InChI=1S/C19H22N4O4S/c1-13-5-4-6-14(2)18(13)20-17(24)12-22(3)19(25)15-7-8-16-21-28(26,27)10-9-23(16)11-15/h4-8,11H,9-10,12H2,1-3H3,(H,20,24) |
| InChIKey | MGMFZJLLNYHGRA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |