C19H19F3N4O4S — CID 27833804
N-ethyl-2,2-dioxo-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 27833804) has the molecular formula C19H19F3N4O4S and a molecular weight of 456.45 g/mol. Its IUPAC name is N-ethyl-2,2-dioxo-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-ethyl-2,2-dioxo-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 27833804 |
| Molecular Formula | C19H19F3N4O4S |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N-ethyl-2,2-dioxo-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | CCN(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)C1=CN2CCS(=O)(=O)N=C2C=C1 |
| InChI | InChI=1S/C19H19F3N4O4S/c1-2-25(12-17(27)23-15-6-4-3-5-14(15)19(20,21)22)18(28)13-7-8-16-24-31(29,30)10-9-26(16)11-13/h3-8,11H,2,9-10,12H2,1H3,(H,23,27) |
| InChIKey | XABKDFFHDTXHFE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |