C24H30N4O3 — CID 46567938
4-[[cyclopropyl-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]methyl]benzamide (PubChem CID 46567938) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-[[cyclopropyl-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]methyl]benzamide.
| Compound Name | 4-[[cyclopropyl-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 46567938 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 4-[[cyclopropyl-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]methyl]benzamide |
| SMILES | COc1ccc(N2CCN(C(=O)CN(Cc3ccc(C(N)=O)cc3)C3CC3)CC2)cc1 |
| InChI | InChI=1S/C24H30N4O3/c1-31-22-10-8-20(9-11-22)26-12-14-27(15-13-26)23(29)17-28(21-6-7-21)16-18-2-4-19(5-3-18)24(25)30/h2-5,8-11,21H,6-7,12-17H2,1H3,(H2,25,30) |
| InChIKey | SXIIJTQZMHOMLL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|