C24H23N3O3S — CID 46569043
N-cyclopropyl-4-[(E)-3-[[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]benzamide (PubChem CID 46569043) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-[[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-[[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 46569043 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-[[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-3-oxoprop-1-enyl]benzamide |
| SMILES | COc1ccc(-c2nc(NC(=O)/C=C/c3ccc(C(=O)NC4CC4)cc3)sc2C)cc1 |
| InChI | InChI=1S/C24H23N3O3S/c1-15-22(17-8-12-20(30-2)13-9-17)27-24(31-15)26-21(28)14-5-16-3-6-18(7-4-16)23(29)25-19-10-11-19/h3-9,12-14,19H,10-11H2,1-2H3,(H,25,29)(H,26,27,28)/b14-5+ |
| InChIKey | JHVVRPJCAFZSEE-LHHJGKSTSA-N |
| XLogP | 4.67 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|