C22H17FN2O4 — CID 46570175
N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-5-(2-fluorophenyl)furan-2-carboxamide (PubChem CID 46570175) has the molecular formula C22H17FN2O4 and a molecular weight of 392.39 g/mol. Its IUPAC name is N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-5-(2-fluorophenyl)furan-2-carboxamide.
| Compound Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-5-(2-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 46570175 |
| Molecular Formula | C22H17FN2O4 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-5-(2-fluorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(CN2C(=O)CCC2=O)cc1)c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C22H17FN2O4/c23-17-4-2-1-3-16(17)18-9-10-19(29-18)22(28)24-15-7-5-14(6-8-15)13-25-20(26)11-12-21(25)27/h1-10H,11-13H2,(H,24,28) |
| InChIKey | RPPZWVKRTZCIKC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|