C25H28N6OS — CID 46574397
N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[(5-propyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide (PubChem CID 46574397) has the molecular formula C25H28N6OS and a molecular weight of 460.61 g/mol. Its IUPAC name is N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[(5-propyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[(5-propyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 46574397 |
| Molecular Formula | C25H28N6OS |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[(5-propyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide |
| SMILES | CCCn1c2ccccc2c2nnc(SCC(=O)Nc3ccc(N4CCCC4)cc3C)nc21 |
| InChI | InChI=1S/C25H28N6OS/c1-3-12-31-21-9-5-4-8-19(21)23-24(31)27-25(29-28-23)33-16-22(32)26-20-11-10-18(15-17(20)2)30-13-6-7-14-30/h4-5,8-11,15H,3,6-7,12-14,16H2,1-2H3,(H,26,32) |
| InChIKey | CHLLXUMCFRGSTB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|