C25H30N4O2S — CID 46606034
2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 46606034) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 46606034 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2-(3-butyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | CCCCn1c(SCC(=O)Nc2ccc(N3CCCC3)cc2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H30N4O2S/c1-3-4-15-29-24(31)20-9-5-6-10-22(20)27-25(29)32-17-23(30)26-21-12-11-19(16-18(21)2)28-13-7-8-14-28/h5-6,9-12,16H,3-4,7-8,13-15,17H2,1-2H3,(H,26,30) |
| InChIKey | KYOMSNYRCBUJMT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|