C21H18N4O4S — CID 46574438
N-[3-[3-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide (PubChem CID 46574438) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is N-[3-[3-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide.
| Compound Name | N-[3-[3-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 46574438 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[3-[3-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-1,2,4-triazol-4-yl]phenyl]acetamide |
| SMILES | COc1ccc2c(CSc3nncn3-c3cccc(NC(C)=O)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H18N4O4S/c1-13(26)23-15-4-3-5-16(9-15)25-12-22-24-21(25)30-11-14-8-20(27)29-19-10-17(28-2)6-7-18(14)19/h3-10,12H,11H2,1-2H3,(H,23,26) |
| InChIKey | CVARRSWWYAGZRK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|