C18H23BrN2O2S — CID 46578257
3-(3-bromo-4-methoxyphenyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]propanamide (PubChem CID 46578257) has the molecular formula C18H23BrN2O2S and a molecular weight of 411.37 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]propanamide.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]propanamide |
|---|---|
| PubChem CID | 46578257 |
| Molecular Formula | C18H23BrN2O2S |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]propanamide |
| SMILES | COc1ccc(CCC(=O)NCC(c2cccs2)N(C)C)cc1Br |
| InChI | InChI=1S/C18H23BrN2O2S/c1-21(2)15(17-5-4-10-24-17)12-20-18(22)9-7-13-6-8-16(23-3)14(19)11-13/h4-6,8,10-11,15H,7,9,12H2,1-3H3,(H,20,22) |
| InChIKey | YLVJXCQBFUDUTR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |