C20H25N3O4S — CID 46585360
N-[3-oxo-3-[[3-(propan-2-ylsulfamoyl)phenyl]methylamino]propyl]benzamide (PubChem CID 46585360) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[3-oxo-3-[[3-(propan-2-ylsulfamoyl)phenyl]methylamino]propyl]benzamide.
| Compound Name | N-[3-oxo-3-[[3-(propan-2-ylsulfamoyl)phenyl]methylamino]propyl]benzamide |
|---|---|
| PubChem CID | 46585360 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[3-oxo-3-[[3-(propan-2-ylsulfamoyl)phenyl]methylamino]propyl]benzamide |
| SMILES | CC(C)NS(=O)(=O)c1cccc(CNC(=O)CCNC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H25N3O4S/c1-15(2)23-28(26,27)18-10-6-7-16(13-18)14-22-19(24)11-12-21-20(25)17-8-4-3-5-9-17/h3-10,13,15,23H,11-12,14H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | YTRRTWZQIJARMJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |