C16H24N2O5S — CID 46469241
propan-2-yl 3-[[3-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate (PubChem CID 46469241) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is propan-2-yl 3-[[3-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate.
| Compound Name | propan-2-yl 3-[[3-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 46469241 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | propan-2-yl 3-[[3-(propan-2-ylsulfamoyl)benzoyl]amino]propanoate |
| SMILES | CC(C)NS(=O)(=O)c1cccc(C(=O)NCCC(=O)OC(C)C)c1 |
| InChI | InChI=1S/C16H24N2O5S/c1-11(2)18-24(21,22)14-7-5-6-13(10-14)16(20)17-9-8-15(19)23-12(3)4/h5-7,10-12,18H,8-9H2,1-4H3,(H,17,20) |
| InChIKey | PDWMMOYMNJORIS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |