C19H20N2O4S — CID 4658597
propan-2-yl 4-cyano-5-[(4-ethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate (PubChem CID 4658597) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is propan-2-yl 4-cyano-5-[(4-ethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate.
| Compound Name | propan-2-yl 4-cyano-5-[(4-ethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 4658597 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | propan-2-yl 4-cyano-5-[(4-ethoxybenzoyl)amino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOc1ccc(C(=O)Nc2sc(C(=O)OC(C)C)c(C)c2C#N)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-5-24-14-8-6-13(7-9-14)17(22)21-18-15(10-20)12(4)16(26-18)19(23)25-11(2)3/h6-9,11H,5H2,1-4H3,(H,21,22) |
| InChIKey | AIOOUWQPSOLOEC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |