C24H20Cl2N2O2 — CID 46588611
N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 46588611) has the molecular formula C24H20Cl2N2O2 and a molecular weight of 439.34 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 46588611 |
| Molecular Formula | C24H20Cl2N2O2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | CC(c1ccc(Cl)cc1Cl)N(C)C(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C24H20Cl2N2O2/c1-15(17-12-11-16(25)13-20(17)26)27(2)23(29)14-28-21-9-5-3-7-18(21)24(30)19-8-4-6-10-22(19)28/h3-13,15H,14H2,1-2H3 |
| InChIKey | KJFRDRBDXYKZKO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|