C19H22FN3OS — CID 46588973
N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide (PubChem CID 46588973) has the molecular formula C19H22FN3OS and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 46588973 |
| Molecular Formula | C19H22FN3OS |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)NCC(c1cccs1)N(C)C |
| InChI | InChI=1S/C19H22FN3OS/c1-12-14(15-9-13(20)6-7-16(15)22-12)10-19(24)21-11-17(23(2)3)18-5-4-8-25-18/h4-9,17,22H,10-11H2,1-3H3,(H,21,24) |
| InChIKey | BKMIENPXWNNANN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|