C18H21ClN4O2 — CID 46589414
1-(3-chlorophenyl)-5-ethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyrazole-4-carboxamide (PubChem CID 46589414) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-ethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-5-ethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46589414 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-(3-chlorophenyl)-5-ethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCC(=O)N2CCCC2)cnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H21ClN4O2/c1-2-16-15(11-21-23(16)14-7-5-6-13(19)10-14)18(25)20-12-17(24)22-8-3-4-9-22/h5-7,10-11H,2-4,8-9,12H2,1H3,(H,20,25) |
| InChIKey | SANKYWJQQLGOCU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |