C21H22ClN5O — CID 32953030
1-(3-chlorophenyl)-5-ethyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrazole-4-carboxamide (PubChem CID 32953030) has the molecular formula C21H22ClN5O and a molecular weight of 395.89 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-ethyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-5-ethyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 32953030 |
| Molecular Formula | C21H22ClN5O |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 1-(3-chlorophenyl)-5-ethyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)Nc2ccc(N3CCCC3)cn2)cnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H22ClN5O/c1-2-19-18(14-24-27(19)16-7-5-6-15(22)12-16)21(28)25-20-9-8-17(13-23-20)26-10-3-4-11-26/h5-9,12-14H,2-4,10-11H2,1H3,(H,23,25,28) |
| InChIKey | PMYQNEUMCXIPCJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |