C20H19ClF2N4O — CID 55864191
1-(3-chlorophenyl)-N-[4-(dimethylamino)-3,5-difluorophenyl]-5-ethylpyrazole-4-carboxamide (PubChem CID 55864191) has the molecular formula C20H19ClF2N4O and a molecular weight of 404.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[4-(dimethylamino)-3,5-difluorophenyl]-5-ethylpyrazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[4-(dimethylamino)-3,5-difluorophenyl]-5-ethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55864191 |
| Molecular Formula | C20H19ClF2N4O |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[4-(dimethylamino)-3,5-difluorophenyl]-5-ethylpyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)Nc2cc(F)c(N(C)C)c(F)c2)cnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19ClF2N4O/c1-4-18-15(11-24-27(18)14-7-5-6-12(21)8-14)20(28)25-13-9-16(22)19(26(2)3)17(23)10-13/h5-11H,4H2,1-3H3,(H,25,28) |
| InChIKey | KJXIMEXTENXPJX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|