C22H20ClFN2O3 — CID 46592936
N-[1-(7-chloro-3-methyl-1-benzofuran-2-carbonyl)piperidin-4-yl]-4-fluorobenzamide (PubChem CID 46592936) has the molecular formula C22H20ClFN2O3 and a molecular weight of 414.86 g/mol. Its IUPAC name is N-[1-(7-chloro-3-methyl-1-benzofuran-2-carbonyl)piperidin-4-yl]-4-fluorobenzamide.
| Compound Name | N-[1-(7-chloro-3-methyl-1-benzofuran-2-carbonyl)piperidin-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 46592936 |
| Molecular Formula | C22H20ClFN2O3 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[1-(7-chloro-3-methyl-1-benzofuran-2-carbonyl)piperidin-4-yl]-4-fluorobenzamide |
| SMILES | Cc1c(C(=O)N2CCC(NC(=O)c3ccc(F)cc3)CC2)oc2c(Cl)cccc12 |
| InChI | InChI=1S/C22H20ClFN2O3/c1-13-17-3-2-4-18(23)20(17)29-19(13)22(28)26-11-9-16(10-12-26)25-21(27)14-5-7-15(24)8-6-14/h2-8,16H,9-12H2,1H3,(H,25,27) |
| InChIKey | RLFQXHZPXQOJKW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |