C21H19ClN6O4 — CID 46594649
2-chloro-N'-[2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]acetyl]benzohydrazide (PubChem CID 46594649) has the molecular formula C21H19ClN6O4 and a molecular weight of 454.87 g/mol. Its IUPAC name is 2-chloro-N'-[2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 46594649 |
| Molecular Formula | C21H19ClN6O4 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-chloro-N'-[2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]acetyl]benzohydrazide |
| SMILES | N#Cc1nc(-c2ccco2)oc1N1CCN(CC(=O)NNC(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H19ClN6O4/c22-15-5-2-1-4-14(15)19(30)26-25-18(29)13-27-7-9-28(10-8-27)21-16(12-23)24-20(32-21)17-6-3-11-31-17/h1-6,11H,7-10,13H2,(H,25,29)(H,26,30) |
| InChIKey | PUSGAOGEACSBQI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|