C23H25N5O4 — CID 30870277
2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]-N-[2-(3-methylphenoxy)ethyl]acetamide (PubChem CID 30870277) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]-N-[2-(3-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]-N-[2-(3-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 30870277 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-[4-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperazin-1-yl]-N-[2-(3-methylphenoxy)ethyl]acetamide |
| SMILES | Cc1cccc(OCCNC(=O)CN2CCN(c3oc(-c4ccco4)nc3C#N)CC2)c1 |
| InChI | InChI=1S/C23H25N5O4/c1-17-4-2-5-18(14-17)30-13-7-25-21(29)16-27-8-10-28(11-9-27)23-19(15-24)26-22(32-23)20-6-3-12-31-20/h2-6,12,14H,7-11,13,16H2,1H3,(H,25,29) |
| InChIKey | CRHCZUCIWKYEPD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|