C23H29N5O2S — CID 46594862
2-[(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl-ethylamino]-N-(3-methoxyphenyl)acetamide (PubChem CID 46594862) has the molecular formula C23H29N5O2S and a molecular weight of 439.59 g/mol. Its IUPAC name is 2-[(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl-ethylamino]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl-ethylamino]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46594862 |
| Molecular Formula | C23H29N5O2S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-[(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl-ethylamino]-N-(3-methoxyphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(OC)c1)Cc1nc(N)c2c3c(sc2n1)CCCCC3 |
| InChI | InChI=1S/C23H29N5O2S/c1-3-28(14-20(29)25-15-8-7-9-16(12-15)30-2)13-19-26-22(24)21-17-10-5-4-6-11-18(17)31-23(21)27-19/h7-9,12H,3-6,10-11,13-14H2,1-2H3,(H,25,29)(H2,24,26,27) |
| InChIKey | SFFFKPURYGKHNC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |