C18H22N4O4 — CID 46598865
3-[(4-methoxyphenyl)carbamoylamino]-N-[(2-methoxy-3-pyridinyl)methyl]propanamide (PubChem CID 46598865) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)carbamoylamino]-N-[(2-methoxy-3-pyridinyl)methyl]propanamide.
| Compound Name | 3-[(4-methoxyphenyl)carbamoylamino]-N-[(2-methoxy-3-pyridinyl)methyl]propanamide |
|---|---|
| PubChem CID | 46598865 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-[(4-methoxyphenyl)carbamoylamino]-N-[(2-methoxy-3-pyridinyl)methyl]propanamide |
| SMILES | COc1ccc(NC(=O)NCCC(=O)NCc2cccnc2OC)cc1 |
| InChI | InChI=1S/C18H22N4O4/c1-25-15-7-5-14(6-8-15)22-18(24)20-11-9-16(23)21-12-13-4-3-10-19-17(13)26-2/h3-8,10H,9,11-12H2,1-2H3,(H,21,23)(H2,20,22,24) |
| InChIKey | LUYNBPDYYDYPJW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |