C24H27N3O3 — CID 46604603
N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide (PubChem CID 46604603) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 46604603 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
| SMILES | COc1cccc(C(CNC(=O)C(=O)c2c(C)[nH]c3ccccc23)N2CCCC2)c1 |
| InChI | InChI=1S/C24H27N3O3/c1-16-22(19-10-3-4-11-20(19)26-16)23(28)24(29)25-15-21(27-12-5-6-13-27)17-8-7-9-18(14-17)30-2/h3-4,7-11,14,21,26H,5-6,12-13,15H2,1-2H3,(H,25,29) |
| InChIKey | NKJVRIJOJDQTQV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|