C22H27N5O4S2 — CID 46605820
N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 46605820) has the molecular formula C22H27N5O4S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 46605820 |
| Molecular Formula | C22H27N5O4S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NN2C(=O)NC(C)(CC)C2=O)nc2sc3c(c2c1=O)CCC(C)C3 |
| InChI | InChI=1S/C22H27N5O4S2/c1-5-9-26-18(29)16-13-8-7-12(3)10-14(13)33-17(16)23-21(26)32-11-15(28)25-27-19(30)22(4,6-2)24-20(27)31/h5,12H,1,6-11H2,2-4H3,(H,24,31)(H,25,28) |
| InChIKey | ISGXLEOQSGFIEZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|