C24H21BrN2O3 — CID 4660687
methyl 4-[6-(4-bromophenyl)-4-(2-hydroxyphenyl)-1,2,3,4-tetrahydropyrimidin-2-yl]benzoate (PubChem CID 4660687) has the molecular formula C24H21BrN2O3 and a molecular weight of 465.35 g/mol. Its IUPAC name is methyl 4-[6-(4-bromophenyl)-4-(2-hydroxyphenyl)-1,2,3,4-tetrahydropyrimidin-2-yl]benzoate.
| Compound Name | methyl 4-[6-(4-bromophenyl)-4-(2-hydroxyphenyl)-1,2,3,4-tetrahydropyrimidin-2-yl]benzoate |
|---|---|
| PubChem CID | 4660687 |
| Molecular Formula | C24H21BrN2O3 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | methyl 4-[6-(4-bromophenyl)-4-(2-hydroxyphenyl)-1,2,3,4-tetrahydropyrimidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2NC(c3ccc(Br)cc3)=CC(c3ccccc3O)N2)cc1 |
| InChI | InChI=1S/C24H21BrN2O3/c1-30-24(29)17-8-6-16(7-9-17)23-26-20(15-10-12-18(25)13-11-15)14-21(27-23)19-4-2-3-5-22(19)28/h2-14,21,23,26-28H,1H3 |
| InChIKey | NJMYVZOQFMRJHN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|