C24H20BrClN2O3 — CID 3253215
methyl 4-[6-(3-bromophenyl)-4-(5-chloro-2-hydroxyphenyl)-1,2,3,4-tetrahydropyrimidin-2-yl]benzoate (PubChem CID 3253215) has the molecular formula C24H20BrClN2O3 and a molecular weight of 499.79 g/mol. Its IUPAC name is methyl 4-[6-(3-bromophenyl)-4-(5-chloro-2-hydroxyphenyl)-1,2,3,4-tetrahydropyrimidin-2-yl]benzoate.
| Compound Name | methyl 4-[6-(3-bromophenyl)-4-(5-chloro-2-hydroxyphenyl)-1,2,3,4-tetrahydropyrimidin-2-yl]benzoate |
|---|---|
| PubChem CID | 3253215 |
| Molecular Formula | C24H20BrClN2O3 |
| Molecular Weight | 499.79 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | methyl 4-[6-(3-bromophenyl)-4-(5-chloro-2-hydroxyphenyl)-1,2,3,4-tetrahydropyrimidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2NC(c3cccc(Br)c3)=CC(c3cc(Cl)ccc3O)N2)cc1 |
| InChI | InChI=1S/C24H20BrClN2O3/c1-31-24(30)15-7-5-14(6-8-15)23-27-20(16-3-2-4-17(25)11-16)13-21(28-23)19-12-18(26)9-10-22(19)29/h2-13,21,23,27-29H,1H3 |
| InChIKey | HEWJRGLNQPKWDY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.79 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|