C23H19Cl2FN2O2 — CID 4606932
4-chloro-2-[2-(2-chloro-6-fluorophenyl)-6-(4-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol (PubChem CID 4606932) has the molecular formula C23H19Cl2FN2O2 and a molecular weight of 445.32 g/mol. Its IUPAC name is 4-chloro-2-[2-(2-chloro-6-fluorophenyl)-6-(4-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol.
| Compound Name | 4-chloro-2-[2-(2-chloro-6-fluorophenyl)-6-(4-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 4606932 |
| Molecular Formula | C23H19Cl2FN2O2 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 4-chloro-2-[2-(2-chloro-6-fluorophenyl)-6-(4-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol |
| SMILES | COc1ccc(C2=CC(c3cc(Cl)ccc3O)NC(c3c(F)cccc3Cl)N2)cc1 |
| InChI | InChI=1S/C23H19Cl2FN2O2/c1-30-15-8-5-13(6-9-15)19-12-20(16-11-14(24)7-10-21(16)29)28-23(27-19)22-17(25)3-2-4-18(22)26/h2-12,20,23,27-29H,1H3 |
| InChIKey | FEQZUWINSWNHNV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|