C22H16BrCl3N2O — CID 5199823
2-[6-(3-bromophenyl)-2-(2,4-dichlorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]-4-chlorophenol (PubChem CID 5199823) has the molecular formula C22H16BrCl3N2O and a molecular weight of 510.65 g/mol. Its IUPAC name is 2-[6-(3-bromophenyl)-2-(2,4-dichlorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]-4-chlorophenol.
| Compound Name | 2-[6-(3-bromophenyl)-2-(2,4-dichlorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 5199823 |
| Molecular Formula | C22H16BrCl3N2O |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 507.95 |
| IUPAC Name | 2-[6-(3-bromophenyl)-2-(2,4-dichlorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]-4-chlorophenol |
| SMILES | Oc1ccc(Cl)cc1C1C=C(c2cccc(Br)c2)NC(c2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C22H16BrCl3N2O/c23-13-3-1-2-12(8-13)19-11-20(17-9-14(24)5-7-21(17)29)28-22(27-19)16-6-4-15(25)10-18(16)26/h1-11,20,22,27-29H |
| InChIKey | NWPIIJHUEMEWDR-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|