C22H16Br2ClFN2O — CID 94486197
2-[(2S,6R)-2-(3-bromo-4-fluorophenyl)-4-(3-bromophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol (PubChem CID 94486197) has the molecular formula C22H16Br2ClFN2O and a molecular weight of 538.64 g/mol. Its IUPAC name is 2-[(2S,6R)-2-(3-bromo-4-fluorophenyl)-4-(3-bromophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol.
| Compound Name | 2-[(2S,6R)-2-(3-bromo-4-fluorophenyl)-4-(3-bromophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 94486197 |
| Molecular Formula | C22H16Br2ClFN2O |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 535.93 |
| IUPAC Name | 2-[(2S,6R)-2-(3-bromo-4-fluorophenyl)-4-(3-bromophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol |
| SMILES | Oc1ccc(Cl)cc1[C@H]1CC(c2cccc(Br)c2)=N[C@@H](c2ccc(F)c(Br)c2)N1 |
| InChI | InChI=1S/C22H16Br2ClFN2O/c23-14-3-1-2-12(8-14)19-11-20(16-10-15(25)5-7-21(16)29)28-22(27-19)13-4-6-18(26)17(24)9-13/h1-10,20,22,28-29H,11H2/t20-,22-/m1/s1 |
| InChIKey | CQOTUWAYKFLCED-IFMALSPDSA-N |
| XLogP | 6.93 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|