C23H17BrClFN2O3 — CID 20970381
2-[4-(1,3-benzodioxol-5-yl)-2-(3-bromo-4-fluorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol (PubChem CID 20970381) has the molecular formula C23H17BrClFN2O3 and a molecular weight of 503.76 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)-2-(3-bromo-4-fluorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)-2-(3-bromo-4-fluorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 20970381 |
| Molecular Formula | C23H17BrClFN2O3 |
| Molecular Weight | 503.76 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)-2-(3-bromo-4-fluorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol |
| SMILES | Oc1ccc(Cl)cc1C1CC(c2ccc3c(c2)OCO3)=NC(c2ccc(F)c(Br)c2)N1 |
| InChI | InChI=1S/C23H17BrClFN2O3/c24-16-7-13(1-4-17(16)26)23-27-18(12-2-6-21-22(8-12)31-11-30-21)10-19(28-23)15-9-14(25)3-5-20(15)29/h1-9,19,23,28-29H,10-11H2 |
| InChIKey | PWHOGYMLSRBVHI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.76 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|