C23H18Br2N2O3 — CID 93473059
2-[(2R,6R)-4-(1,3-benzodioxol-5-yl)-2-(4-bromophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-bromophenol (PubChem CID 93473059) has the molecular formula C23H18Br2N2O3 and a molecular weight of 530.22 g/mol. Its IUPAC name is 2-[(2R,6R)-4-(1,3-benzodioxol-5-yl)-2-(4-bromophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-bromophenol.
| Compound Name | 2-[(2R,6R)-4-(1,3-benzodioxol-5-yl)-2-(4-bromophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-bromophenol |
|---|---|
| PubChem CID | 93473059 |
| Molecular Formula | C23H18Br2N2O3 |
| Molecular Weight | 530.22 g/mol |
| Exact Mass | 527.97 |
| IUPAC Name | 2-[(2R,6R)-4-(1,3-benzodioxol-5-yl)-2-(4-bromophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-4-bromophenol |
| SMILES | Oc1ccc(Br)cc1[C@H]1CC(c2ccc3c(c2)OCO3)=N[C@H](c2ccc(Br)cc2)N1 |
| InChI | InChI=1S/C23H18Br2N2O3/c24-15-4-1-13(2-5-15)23-26-18(14-3-8-21-22(9-14)30-12-29-21)11-19(27-23)17-10-16(25)6-7-20(17)28/h1-10,19,23,27-28H,11-12H2/t19-,23+/m1/s1 |
| InChIKey | KGFYWZORBYMPPZ-XXBNENTESA-N |
| XLogP | 5.87 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.22 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|