C25H23ClN2O4 — CID 94485663
2-[(2S,6S)-4-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol (PubChem CID 94485663) has the molecular formula C25H23ClN2O4 and a molecular weight of 450.92 g/mol. Its IUPAC name is 2-[(2S,6S)-4-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol.
| Compound Name | 2-[(2S,6S)-4-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 94485663 |
| Molecular Formula | C25H23ClN2O4 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-[(2S,6S)-4-(1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol |
| SMILES | CCOc1cccc([C@@H]2CC(c3ccc4c(c3)OCO4)=N[C@@H](c3ccc(Cl)cc3)N2)c1O |
| InChI | InChI=1S/C25H23ClN2O4/c1-2-30-22-5-3-4-18(24(22)29)20-13-19(16-8-11-21-23(12-16)32-14-31-21)27-25(28-20)15-6-9-17(26)10-7-15/h3-12,20,25,28-29H,2,13-14H2,1H3/t20-,25+/m0/s1 |
| InChIKey | DKTJEGHYHGSWGG-NBGIEHNGSA-N |
| XLogP | 5.40 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|