C25H25ClN2O2 — CID 94485456
2-[(2R,6S)-2-(4-chlorophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol (PubChem CID 94485456) has the molecular formula C25H25ClN2O2 and a molecular weight of 420.94 g/mol. Its IUPAC name is 2-[(2R,6S)-2-(4-chlorophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol.
| Compound Name | 2-[(2R,6S)-2-(4-chlorophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 94485456 |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-[(2R,6S)-2-(4-chlorophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol |
| SMILES | CCOc1cccc([C@@H]2CC(c3ccc(C)cc3)=N[C@H](c3ccc(Cl)cc3)N2)c1O |
| InChI | InChI=1S/C25H25ClN2O2/c1-3-30-23-6-4-5-20(24(23)29)22-15-21(17-9-7-16(2)8-10-17)27-25(28-22)18-11-13-19(26)14-12-18/h4-14,22,25,28-29H,3,15H2,1-2H3/t22-,25-/m0/s1 |
| InChIKey | OFSHJLQGXOUZSR-DHLKQENFSA-N |
| XLogP | 5.98 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|