C22H18BrClN2O — CID 3687532
2-[6-(3-bromophenyl)-2-(4-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol (PubChem CID 3687532) has the molecular formula C22H18BrClN2O and a molecular weight of 441.76 g/mol. Its IUPAC name is 2-[6-(3-bromophenyl)-2-(4-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol.
| Compound Name | 2-[6-(3-bromophenyl)-2-(4-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 3687532 |
| Molecular Formula | C22H18BrClN2O |
| Molecular Weight | 441.76 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 2-[6-(3-bromophenyl)-2-(4-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol |
| SMILES | Oc1ccccc1C1C=C(c2cccc(Br)c2)NC(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C22H18BrClN2O/c23-16-5-3-4-15(12-16)19-13-20(18-6-1-2-7-21(18)27)26-22(25-19)14-8-10-17(24)11-9-14/h1-13,20,22,25-27H |
| InChIKey | NBGIYHQLCNVPNC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.76 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|