C24H22ClFN2O2 — CID 3435694
2-[6-(4-chlorophenyl)-2-(3-fluorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]-6-ethoxyphenol (PubChem CID 3435694) has the molecular formula C24H22ClFN2O2 and a molecular weight of 424.90 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)-2-(3-fluorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]-6-ethoxyphenol.
| Compound Name | 2-[6-(4-chlorophenyl)-2-(3-fluorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 3435694 |
| Molecular Formula | C24H22ClFN2O2 |
| Molecular Weight | 424.90 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-[6-(4-chlorophenyl)-2-(3-fluorophenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]-6-ethoxyphenol |
| SMILES | CCOc1cccc(C2C=C(c3ccc(Cl)cc3)NC(c3cccc(F)c3)N2)c1O |
| InChI | InChI=1S/C24H22ClFN2O2/c1-2-30-22-8-4-7-19(23(22)29)21-14-20(15-9-11-17(25)12-10-15)27-24(28-21)16-5-3-6-18(26)13-16/h3-14,21,24,27-29H,2H2,1H3 |
| InChIKey | CKNUVTKYQOOPDH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.90 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|