C24H23Cl2N2O2+ — CID 3435687
2-[2,6-bis(4-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]-6-ethoxyphenol (PubChem CID 3435687) has the molecular formula C24H23Cl2N2O2+ and a molecular weight of 442.37 g/mol. Its IUPAC name is 2-[2,6-bis(4-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]-6-ethoxyphenol.
| Compound Name | 2-[2,6-bis(4-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 3435687 |
| Molecular Formula | C24H23Cl2N2O2+ |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[2,6-bis(4-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]-6-ethoxyphenol |
| SMILES | CCOc1cccc(C2C=C(c3ccc(Cl)cc3)NC(c3ccc(Cl)cc3)[NH2+]2)c1O |
| InChI | InChI=1S/C24H22Cl2N2O2/c1-2-30-22-5-3-4-19(23(22)29)21-14-20(15-6-10-17(25)11-7-15)27-24(28-21)16-8-12-18(26)13-9-16/h3-14,21,24,27-29H,2H2,1H3/p+1 |
| InChIKey | MXVIJZLSHIPIFP-UHFFFAOYSA-O |
| XLogP | 5.05 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|