C27H30N2O3 — CID 5187175
2-ethoxy-6-[6-(4-ethylphenyl)-2-(3-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol (PubChem CID 5187175) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-ethoxy-6-[6-(4-ethylphenyl)-2-(3-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol.
| Compound Name | 2-ethoxy-6-[6-(4-ethylphenyl)-2-(3-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 5187175 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 2-ethoxy-6-[6-(4-ethylphenyl)-2-(3-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol |
| SMILES | CCOc1cccc(C2C=C(c3ccc(CC)cc3)NC(c3cccc(OC)c3)N2)c1O |
| InChI | InChI=1S/C27H30N2O3/c1-4-18-12-14-19(15-13-18)23-17-24(22-10-7-11-25(26(22)30)32-5-2)29-27(28-23)20-8-6-9-21(16-20)31-3/h6-17,24,27-30H,4-5H2,1-3H3 |
| InChIKey | JWIAFXWRTOUGQS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|