C25H25FN2O3 — CID 5073441
2-ethoxy-6-[2-(2-fluorophenyl)-6-(3-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol (PubChem CID 5073441) has the molecular formula C25H25FN2O3 and a molecular weight of 420.48 g/mol. Its IUPAC name is 2-ethoxy-6-[2-(2-fluorophenyl)-6-(3-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol.
| Compound Name | 2-ethoxy-6-[2-(2-fluorophenyl)-6-(3-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 5073441 |
| Molecular Formula | C25H25FN2O3 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-ethoxy-6-[2-(2-fluorophenyl)-6-(3-methoxyphenyl)-1,2,3,4-tetrahydropyrimidin-4-yl]phenol |
| SMILES | CCOc1cccc(C2C=C(c3cccc(OC)c3)NC(c3ccccc3F)N2)c1O |
| InChI | InChI=1S/C25H25FN2O3/c1-3-31-23-13-7-11-19(24(23)29)22-15-21(16-8-6-9-17(14-16)30-2)27-25(28-22)18-10-4-5-12-20(18)26/h4-15,22,25,27-29H,3H2,1-2H3 |
| InChIKey | PZXAHYNFALYUDC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|