C24H29NO6 — CID 46607100
methyl 2-[[2-[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]oxyacetyl]amino]-3-phenylpropanoate (PubChem CID 46607100) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is methyl 2-[[2-[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]oxyacetyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[2-[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]oxyacetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 46607100 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | methyl 2-[[2-[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]oxyacetyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)COC(=O)COc1ccc(C(C)C)c(C)c1 |
| InChI | InChI=1S/C24H29NO6/c1-16(2)20-11-10-19(12-17(20)3)30-15-23(27)31-14-22(26)25-21(24(28)29-4)13-18-8-6-5-7-9-18/h5-12,16,21H,13-15H2,1-4H3,(H,25,26) |
| InChIKey | GGBIZKPJPSVTTB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |