C20H25NO4S — CID 8951493
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate (PubChem CID 8951493) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 8951493 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate |
| SMILES | Cc1cc(OCC(=O)OCC(=O)NCCc2cccs2)ccc1C(C)C |
| InChI | InChI=1S/C20H25NO4S/c1-14(2)18-7-6-16(11-15(18)3)24-13-20(23)25-12-19(22)21-9-8-17-5-4-10-26-17/h4-7,10-11,14H,8-9,12-13H2,1-3H3,(H,21,22) |
| InChIKey | VZCWYAMQOKKHAX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |