C24H26N2O5 — CID 46609947
[1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 46609947) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is [1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 46609947 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [1-[4-(2-methylpropanoylamino)phenyl]-1-oxopropan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)C(C)OC(=O)c2cccc(N3CCCC3=O)c2)cc1 |
| InChI | InChI=1S/C24H26N2O5/c1-15(2)23(29)25-19-11-9-17(10-12-19)22(28)16(3)31-24(30)18-6-4-7-20(14-18)26-13-5-8-21(26)27/h4,6-7,9-12,14-16H,5,8,13H2,1-3H3,(H,25,29) |
| InChIKey | VVKCLPXNDAYHFD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |