C20H17F3N2O4 — CID 8727915
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 8727915) has the molecular formula C20H17F3N2O4 and a molecular weight of 406.36 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 8727915 |
| Molecular Formula | C20H17F3N2O4 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | C[C@H](OC(=O)c1cccc(N2CCCC2=O)c1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H17F3N2O4/c1-11(19(27)24-15-8-7-14(21)17(22)18(15)23)29-20(28)12-4-2-5-13(10-12)25-9-3-6-16(25)26/h2,4-5,7-8,10-11H,3,6,9H2,1H3,(H,24,27)/t11-/m0/s1 |
| InChIKey | RBBPWGRIQIDMPX-NSHDSACASA-N |
| XLogP | 3.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|