C30H34N2O2S — CID 4661050
N-benzyl-4-(4-tert-butylphenoxy)-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)butanamide (PubChem CID 4661050) has the molecular formula C30H34N2O2S and a molecular weight of 486.68 g/mol. Its IUPAC name is N-benzyl-4-(4-tert-butylphenoxy)-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | N-benzyl-4-(4-tert-butylphenoxy)-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 4661050 |
| Molecular Formula | C30H34N2O2S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-benzyl-4-(4-tert-butylphenoxy)-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)butanamide |
| SMILES | Cc1cc(C)c2nc(N(Cc3ccccc3)C(=O)CCCOc3ccc(C(C)(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C30H34N2O2S/c1-21-18-22(2)28-26(19-21)35-29(31-28)32(20-23-10-7-6-8-11-23)27(33)12-9-17-34-25-15-13-24(14-16-25)30(3,4)5/h6-8,10-11,13-16,18-19H,9,12,17,20H2,1-5H3 |
| InChIKey | PUVSLGBJDFSZNX-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|