C20H20INO4 — CID 46611519
[2-(2-iodoanilino)-2-oxoethyl] 4-(3,4-dimethylphenyl)-4-oxobutanoate (PubChem CID 46611519) has the molecular formula C20H20INO4 and a molecular weight of 465.29 g/mol. Its IUPAC name is [2-(2-iodoanilino)-2-oxoethyl] 4-(3,4-dimethylphenyl)-4-oxobutanoate.
| Compound Name | [2-(2-iodoanilino)-2-oxoethyl] 4-(3,4-dimethylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 46611519 |
| Molecular Formula | C20H20INO4 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | [2-(2-iodoanilino)-2-oxoethyl] 4-(3,4-dimethylphenyl)-4-oxobutanoate |
| SMILES | Cc1ccc(C(=O)CCC(=O)OCC(=O)Nc2ccccc2I)cc1C |
| InChI | InChI=1S/C20H20INO4/c1-13-7-8-15(11-14(13)2)18(23)9-10-20(25)26-12-19(24)22-17-6-4-3-5-16(17)21/h3-8,11H,9-10,12H2,1-2H3,(H,22,24) |
| InChIKey | IQVNTGHQSIFBQE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|