C24H30N6OS — CID 46618453
2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)propan-1-one (PubChem CID 46618453) has the molecular formula C24H30N6OS and a molecular weight of 450.61 g/mol. Its IUPAC name is 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)propan-1-one.
| Compound Name | 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 46618453 |
| Molecular Formula | C24H30N6OS |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)propan-1-one |
| SMILES | CCCCc1ccc(-n2nnnc2SC(C)C(=O)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H30N6OS/c1-3-4-8-20-11-13-22(14-12-20)30-24(25-26-27-30)32-19(2)23(31)29-17-15-28(16-18-29)21-9-6-5-7-10-21/h5-7,9-14,19H,3-4,8,15-18H2,1-2H3 |
| InChIKey | FBXCLNKWZSEDPF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |