C24H18FN3O4 — CID 4661995
2-cyano-3-[2-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 4661995) has the molecular formula C24H18FN3O4 and a molecular weight of 431.42 g/mol. Its IUPAC name is 2-cyano-3-[2-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[2-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4661995 |
| Molecular Formula | C24H18FN3O4 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-cyano-3-[2-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-N-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccccc1OCC(=O)Nc1ccccc1F)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C24H18FN3O4/c25-20-6-2-3-7-21(20)28-23(30)15-32-22-8-4-1-5-16(22)13-17(14-26)24(31)27-18-9-11-19(29)12-10-18/h1-13,29H,15H2,(H,27,31)(H,28,30) |
| InChIKey | VEDNMRBZJWQOSA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|