C19H17FN2O7 — CID 46624471
1-O-ethyl 3-O-[1-(3-fluoroanilino)-1-oxopropan-2-yl] 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 46624471) has the molecular formula C19H17FN2O7 and a molecular weight of 404.35 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[1-(3-fluoroanilino)-1-oxopropan-2-yl] 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 1-O-ethyl 3-O-[1-(3-fluoroanilino)-1-oxopropan-2-yl] 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 46624471 |
| Molecular Formula | C19H17FN2O7 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 1-O-ethyl 3-O-[1-(3-fluoroanilino)-1-oxopropan-2-yl] 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OC(C)C(=O)Nc2cccc(F)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17FN2O7/c1-3-28-18(24)12-7-13(9-16(8-12)22(26)27)19(25)29-11(2)17(23)21-15-6-4-5-14(20)10-15/h4-11H,3H2,1-2H3,(H,21,23) |
| InChIKey | KCGODRSKRIHBOI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|