C17H15ClN2OS2 — CID 46626799
2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-(2-chlorophenyl)propanamide (PubChem CID 46626799) has the molecular formula C17H15ClN2OS2 and a molecular weight of 362.91 g/mol. Its IUPAC name is 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-(2-chlorophenyl)propanamide.
| Compound Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-(2-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 46626799 |
| Molecular Formula | C17H15ClN2OS2 |
| Molecular Weight | 362.91 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-N-(2-chlorophenyl)propanamide |
| SMILES | CC(SC1=Nc2ccccc2CS1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H15ClN2OS2/c1-11(16(21)19-15-9-5-3-7-13(15)18)23-17-20-14-8-4-2-6-12(14)10-22-17/h2-9,11H,10H2,1H3,(H,19,21) |
| InChIKey | RRJXHDKHTJCBPK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.91 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |